C16H14F3NO2 — CID 44592443
(+/-)-Methyl 4-(1-amino-2-(2,4,5-trifluorophenyl)ethyl)benzoate (PubChem CID 44592443) has the molecular formula C16H14F3NO2 and a molecular weight of 309.28 g/mol. Its IUPAC name is methyl 4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]benzoate.
| Compound Name | (+/-)-Methyl 4-(1-amino-2-(2,4,5-trifluorophenyl)ethyl)benzoate |
|---|---|
| PubChem CID | 44592443 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 4-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]benzoate |
| SMILES | COC(=O)C1=CC=C(C=C1)C(CC2=CC(=C(C=C2F)F)F)N |
| InChI | InChI=1S/C16H14F3NO2/c1-22-16(21)10-4-2-9(3-5-10)15(20)7-11-6-13(18)14(19)8-12(11)17/h2-6,8,15H,7,20H2,1H3 |
| InChIKey | YGYBYQYARMLNPQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | 374 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|