C26H27ClFIN6O4 — CID 118424150
[1-[3-[[4-[[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]carbamoyl]-1H-imidazole-5-carbonyl]amino]propyl]piperidin-3-yl] hypoiodite (PubChem CID 118424150) has the molecular formula C26H27ClFIN6O4 and a molecular weight of 668.90 g/mol. Its IUPAC name is [1-[3-[[4-[[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]carbamoyl]-1H-imidazole-5-carbonyl]amino]propyl]piperidin-3-yl] hypoiodite.
| Compound Name | [1-[3-[[4-[[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]carbamoyl]-1H-imidazole-5-carbonyl]amino]propyl]piperidin-3-yl] hypoiodite |
|---|---|
| PubChem CID | 118424150 |
| Molecular Formula | C26H27ClFIN6O4 |
| Molecular Weight | 668.90 g/mol |
| Exact Mass | 668.08 |
| IUPAC Name | [1-[3-[[4-[[4-[(2-chloro-4-fluorobenzoyl)amino]phenyl]carbamoyl]-1H-imidazole-5-carbonyl]amino]propyl]piperidin-3-yl] hypoiodite |
| SMILES | O=C(Nc1ccc(NC(=O)c2nc[nH]c2C(=O)NCCCN2CCCC(OI)C2)cc1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C26H27ClFIN6O4/c27-21-13-16(28)4-9-20(21)24(36)33-17-5-7-18(8-6-17)34-26(38)23-22(31-15-32-23)25(37)30-10-2-12-35-11-1-3-19(14-35)39-29/h4-9,13,15,19H,1-3,10-12,14H2,(H,30,37)(H,31,32)(H,33,36)(H,34,38) |
| InChIKey | PYESLFAYMCLYGT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.90 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|