C33H29F8NO6S — CID 118425518
tert-butyl 4-[2-[[6-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 118425518) has the molecular formula C33H29F8NO6S and a molecular weight of 719.65 g/mol. Its IUPAC name is tert-butyl 4-[2-[[6-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[6-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 118425518 |
| Molecular Formula | C33H29F8NO6S |
| Molecular Weight | 719.65 g/mol |
| Exact Mass | 719.16 |
| IUPAC Name | tert-butyl 4-[2-[[6-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-5-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cc(C(F)(F)F)ccc2OC2CCCc3cc(S(=O)(=O)Oc4c(F)c(F)c(F)c(F)c4F)ccc32)CC1 |
| InChI | InChI=1S/C33H29F8NO6S/c1-32(2,3)47-31(43)42-13-11-17(12-14-42)22-16-19(33(39,40)41)7-10-24(22)46-23-6-4-5-18-15-20(8-9-21(18)23)49(44,45)48-30-28(37)26(35)25(34)27(36)29(30)38/h7-11,15-16,23H,4-6,12-14H2,1-3H3 |
| InChIKey | XZYHUBUTUFHNHD-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.65 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|