C31H28F8N2O5S — CID 135324950
tert-butyl 4-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 135324950) has the molecular formula C31H28F8N2O5S and a molecular weight of 692.62 g/mol. Its IUPAC name is tert-butyl 4-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 135324950 |
| Molecular Formula | C31H28F8N2O5S |
| Molecular Weight | 692.62 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | tert-butyl 4-[2-[5-(2,3,4,5,6-pentafluorophenoxy)sulfonyl-2,3-dihydro-1H-inden-1-yl]-5-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc(C(F)(F)F)ccc2C2CCc3cc(S(=O)(=O)Oc4c(F)c(F)c(F)c(F)c4F)ccc32)CC1 |
| InChI | InChI=1S/C31H28F8N2O5S/c1-30(2,3)45-29(42)41-12-10-40(11-13-41)22-15-17(31(37,38)39)5-8-21(22)20-7-4-16-14-18(6-9-19(16)20)47(43,44)46-28-26(35)24(33)23(32)25(34)27(28)36/h5-6,8-9,14-15,20H,4,7,10-13H2,1-3H3 |
| InChIKey | CFULMKCPRJKBMC-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|