C18H23F2N5O2 — CID 118425876
1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carboxylic acid (PubChem CID 118425876) has the molecular formula C18H23F2N5O2 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carboxylic acid.
| Compound Name | 1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 118425876 |
| Molecular Formula | C18H23F2N5O2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-(6,6-difluoro-5,7,8,9-tetrahydropyrimido[4,5-b]indol-4-yl)-4-(dimethylamino)piperidine-4-carboxylic acid |
| SMILES | CN(C)C1(C(=O)O)CCN(c2ncnc3[nH]c4c(c23)CC(F)(F)CC4)CC1 |
| InChI | InChI=1S/C18H23F2N5O2/c1-24(2)17(16(26)27)5-7-25(8-6-17)15-13-11-9-18(19,20)4-3-12(11)23-14(13)21-10-22-15/h10H,3-9H2,1-2H3,(H,26,27)(H,21,22,23) |
| InChIKey | KGUCVGSRHRRLBB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |