C27H35N7O3 — CID 127047267
[3-[[4-(dimethylamino)-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamate (PubChem CID 127047267) has the molecular formula C27H35N7O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is [3-[[4-(dimethylamino)-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamate.
| Compound Name | [3-[[4-(dimethylamino)-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 127047267 |
| Molecular Formula | C27H35N7O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | [3-[[4-(dimethylamino)-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carbonyl]amino]phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc(NC(=O)C2(N(C)C)CCN(c3ncnc4[nH]c5c(c34)CCCC5)CC2)c1 |
| InChI | InChI=1S/C27H35N7O3/c1-32(2)26(36)37-19-9-7-8-18(16-19)30-25(35)27(33(3)4)12-14-34(15-13-27)24-22-20-10-5-6-11-21(20)31-23(22)28-17-29-24/h7-9,16-17H,5-6,10-15H2,1-4H3,(H,30,35)(H,28,29,31) |
| InChIKey | IIALFTYNTCYIML-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |