C27H32N8O — CID 127045879
4-(dimethylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide (PubChem CID 127045879) has the molecular formula C27H32N8O and a molecular weight of 484.61 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide.
| Compound Name | 4-(dimethylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 127045879 |
| Molecular Formula | C27H32N8O |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 4-(dimethylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]-1-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)piperidine-4-carboxamide |
| SMILES | CN(C)C1(C(=O)Nc2cccc(-c3ccn[nH]3)c2)CCN(c2ncnc3[nH]c4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C27H32N8O/c1-34(2)27(26(36)31-19-7-5-6-18(16-19)21-10-13-30-33-21)11-14-35(15-12-27)25-23-20-8-3-4-9-22(20)32-24(23)28-17-29-25/h5-7,10,13,16-17H,3-4,8-9,11-12,14-15H2,1-2H3,(H,30,33)(H,31,36)(H,28,29,32) |
| InChIKey | PAOKFNVXQHEMAT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |