C20H30N6O — CID 91834454
1-[[4-(dimethylamino)-1-ethylpiperidin-4-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea (PubChem CID 91834454) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-1-ethylpiperidin-4-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea.
| Compound Name | 1-[[4-(dimethylamino)-1-ethylpiperidin-4-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 91834454 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-[[4-(dimethylamino)-1-ethylpiperidin-4-yl]methyl]-3-[3-(1H-pyrazol-5-yl)phenyl]urea |
| SMILES | CCN1CCC(CNC(=O)Nc2cccc(-c3ccn[nH]3)c2)(N(C)C)CC1 |
| InChI | InChI=1S/C20H30N6O/c1-4-26-12-9-20(10-13-26,25(2)3)15-21-19(27)23-17-7-5-6-16(14-17)18-8-11-22-24-18/h5-8,11,14H,4,9-10,12-13,15H2,1-3H3,(H,22,24)(H2,21,23,27) |
| InChIKey | IAJDKZPTSIZGNT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |