C22H22FN5O — CID 162361954
N-(3-fluorophenyl)-4-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 162361954) has the molecular formula C22H22FN5O and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 162361954 |
| Molecular Formula | C22H22FN5O |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-(3-fluorophenyl)-4-(6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1CC=C(c2ncnc3[nH]c4c(c23)CCCC4)CC1 |
| InChI | InChI=1S/C22H22FN5O/c23-15-4-3-5-16(12-15)26-22(29)28-10-8-14(9-11-28)20-19-17-6-1-2-7-18(17)27-21(19)25-13-24-20/h3-5,8,12-13H,1-2,6-7,9-11H2,(H,26,29)(H,24,25,27) |
| InChIKey | CRQMPLKPSNDETC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |