C22H17N3O2 — CID 118428198
(E)-3-[3-(naphthalen-1-ylmethyl)-2-pyridin-3-ylimidazol-4-yl]prop-2-enoic acid (PubChem CID 118428198) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is (E)-3-[3-(naphthalen-1-ylmethyl)-2-pyridin-3-ylimidazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(naphthalen-1-ylmethyl)-2-pyridin-3-ylimidazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118428198 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (E)-3-[3-(naphthalen-1-ylmethyl)-2-pyridin-3-ylimidazol-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(-c2cccnc2)n1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H17N3O2/c26-21(27)11-10-19-14-24-22(17-8-4-12-23-13-17)25(19)15-18-7-3-6-16-5-1-2-9-20(16)18/h1-14H,15H2,(H,26,27)/b11-10+ |
| InChIKey | UHVUQLUJOZIOLH-ZHACJKMWSA-N |
| XLogP | 4.24 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|