C27H21N3O3 — CID 118416804
5-methyl-3-(naphthalen-1-ylmethyl)-2-(5-phenoxy-3-pyridinyl)imidazole-4-carboxylic acid (PubChem CID 118416804) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is 5-methyl-3-(naphthalen-1-ylmethyl)-2-(5-phenoxy-3-pyridinyl)imidazole-4-carboxylic acid.
| Compound Name | 5-methyl-3-(naphthalen-1-ylmethyl)-2-(5-phenoxy-3-pyridinyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 118416804 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 5-methyl-3-(naphthalen-1-ylmethyl)-2-(5-phenoxy-3-pyridinyl)imidazole-4-carboxylic acid |
| SMILES | Cc1nc(-c2cncc(Oc3ccccc3)c2)n(Cc2cccc3ccccc23)c1C(=O)O |
| InChI | InChI=1S/C27H21N3O3/c1-18-25(27(31)32)30(17-20-10-7-9-19-8-5-6-13-24(19)20)26(29-18)21-14-23(16-28-15-21)33-22-11-3-2-4-12-22/h2-16H,17H2,1H3,(H,31,32) |
| InChIKey | LORWNMWYZLFVEI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |