C22H17ClN4O — CID 134228721
2-chloro-4-[4-methyl-1-(naphthalen-1-ylmethyl)-5-(1-nitrosoethenyl)imidazol-2-yl]pyridine (PubChem CID 134228721) has the molecular formula C22H17ClN4O and a molecular weight of 388.86 g/mol. Its IUPAC name is 2-chloro-4-[4-methyl-1-(naphthalen-1-ylmethyl)-5-(1-nitrosoethenyl)imidazol-2-yl]pyridine.
| Compound Name | 2-chloro-4-[4-methyl-1-(naphthalen-1-ylmethyl)-5-(1-nitrosoethenyl)imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 134228721 |
| Molecular Formula | C22H17ClN4O |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-chloro-4-[4-methyl-1-(naphthalen-1-ylmethyl)-5-(1-nitrosoethenyl)imidazol-2-yl]pyridine |
| SMILES | C=C(N=O)c1c(C)nc(-c2ccnc(Cl)c2)n1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H17ClN4O/c1-14-21(15(2)26-28)27(22(25-14)17-10-11-24-20(23)12-17)13-18-8-5-7-16-6-3-4-9-19(16)18/h3-12H,2,13H2,1H3 |
| InChIKey | BWPGXFFXMVSXGD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|