C25H22N6O2S4 — CID 118428602
1-[4-[3-[[4-(2-dithiocarboxyimidazol-1-yl)benzoyl]amino]propylcarbamoyl]phenyl]imidazole-2-carbodithioic acid (PubChem CID 118428602) has the molecular formula C25H22N6O2S4 and a molecular weight of 566.76 g/mol. Its IUPAC name is 1-[4-[3-[[4-(2-dithiocarboxyimidazol-1-yl)benzoyl]amino]propylcarbamoyl]phenyl]imidazole-2-carbodithioic acid.
| Compound Name | 1-[4-[3-[[4-(2-dithiocarboxyimidazol-1-yl)benzoyl]amino]propylcarbamoyl]phenyl]imidazole-2-carbodithioic acid |
|---|---|
| PubChem CID | 118428602 |
| Molecular Formula | C25H22N6O2S4 |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | 1-[4-[3-[[4-(2-dithiocarboxyimidazol-1-yl)benzoyl]amino]propylcarbamoyl]phenyl]imidazole-2-carbodithioic acid |
| SMILES | O=C(NCCCNC(=O)c1ccc(-n2ccnc2C(=S)S)cc1)c1ccc(-n2ccnc2C(=S)S)cc1 |
| InChI | InChI=1S/C25H22N6O2S4/c32-22(16-2-6-18(7-3-16)30-14-12-26-20(30)24(34)35)28-10-1-11-29-23(33)17-4-8-19(9-5-17)31-15-13-27-21(31)25(36)37/h2-9,12-15H,1,10-11H2,(H,28,32)(H,29,33)(H,34,35)(H,36,37) |
| InChIKey | XFOKWPMEBOIQBK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|