C18H18N4O3S — CID 55775678
N-[2-[[4-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 55775678) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[2-[[4-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55775678 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[2-[[4-(2-methylsulfanylimidazol-1-yl)benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CSc1nccn1-c1ccc(C(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-26-18-21-10-11-22(18)14-6-4-13(5-7-14)16(23)19-8-9-20-17(24)15-3-2-12-25-15/h2-7,10-12H,8-9H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | PIQDKSLJCRAQQE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|