C21H29N3O3S — CID 95787672
N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-(2-methylsulfanylimidazol-1-yl)benzamide (PubChem CID 95787672) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-(2-methylsulfanylimidazol-1-yl)benzamide.
| Compound Name | N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-(2-methylsulfanylimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 95787672 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[(4S)-4-(1,3-dioxolan-2-yl)-4-methylhexyl]-4-(2-methylsulfanylimidazol-1-yl)benzamide |
| SMILES | CC[C@@](C)(CCCNC(=O)c1ccc(-n2ccnc2SC)cc1)C1OCCO1 |
| InChI | InChI=1S/C21H29N3O3S/c1-4-21(2,19-26-14-15-27-19)10-5-11-22-18(25)16-6-8-17(9-7-16)24-13-12-23-20(24)28-3/h6-9,12-13,19H,4-5,10-11,14-15H2,1-3H3,(H,22,25)/t21-/m0/s1 |
| InChIKey | CXGPUABJNDMYAC-NRFANRHFSA-N |
| XLogP | 3.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|