C25H31N5OS — CID 55931176
3-(2-methylsulfanylimidazol-1-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide (PubChem CID 55931176) has the molecular formula C25H31N5OS and a molecular weight of 449.62 g/mol. Its IUPAC name is 3-(2-methylsulfanylimidazol-1-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 3-(2-methylsulfanylimidazol-1-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55931176 |
| Molecular Formula | C25H31N5OS |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-(2-methylsulfanylimidazol-1-yl)-N-[4-(4-phenylpiperazin-1-yl)butyl]benzamide |
| SMILES | CSc1nccn1-c1cccc(C(=O)NCCCCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H31N5OS/c1-32-25-27-13-15-30(25)23-11-7-8-21(20-23)24(31)26-12-5-6-14-28-16-18-29(19-17-28)22-9-3-2-4-10-22/h2-4,7-11,13,15,20H,5-6,12,14,16-19H2,1H3,(H,26,31) |
| InChIKey | WEXBVUPFJSQGCX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|