C20H18ClF3N2O3 — CID 118429123
2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(dimethylamino)ethoxy]isoindole-1,3-dione (PubChem CID 118429123) has the molecular formula C20H18ClF3N2O3 and a molecular weight of 426.82 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(dimethylamino)ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(dimethylamino)ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118429123 |
| Molecular Formula | C20H18ClF3N2O3 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(dimethylamino)ethoxy]isoindole-1,3-dione |
| SMILES | CN(C)CCOc1cccc2c1C(=O)N(Cc1ccc(Cl)c(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C20H18ClF3N2O3/c1-25(2)8-9-29-16-5-3-4-13-17(16)19(28)26(18(13)27)11-12-6-7-15(21)14(10-12)20(22,23)24/h3-7,10H,8-9,11H2,1-2H3 |
| InChIKey | HBHMUJUJYVOXPP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|