C24H28ClF3N2O3 — CID 144939541
2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(diethylamino)ethoxy]isoindole-1,3-dione;ethane (PubChem CID 144939541) has the molecular formula C24H28ClF3N2O3 and a molecular weight of 484.95 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(diethylamino)ethoxy]isoindole-1,3-dione;ethane.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(diethylamino)ethoxy]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 144939541 |
| Molecular Formula | C24H28ClF3N2O3 |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4-[2-(diethylamino)ethoxy]isoindole-1,3-dione;ethane |
| SMILES | CC.CCN(CC)CCOc1cccc2c1C(=O)N(Cc1ccc(Cl)c(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C22H22ClF3N2O3.C2H6/c1-3-27(4-2)10-11-31-18-7-5-6-15-19(18)21(30)28(20(15)29)13-14-8-9-17(23)16(12-14)22(24,25)26;1-2/h5-9,12H,3-4,10-11,13H2,1-2H3;1-2H3 |
| InChIKey | ULXLXJPXAVJOOP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|