C13H15N4O3+ — CID 11843218
6-(4-morpholin-4-ylpyridin-1-ium-1-yl)-1H-pyrimidine-2,4-dione (PubChem CID 11843218) has the molecular formula C13H15N4O3+ and a molecular weight of 275.29 g/mol. Its IUPAC name is 6-(4-morpholin-4-ylpyridin-1-ium-1-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(4-morpholin-4-ylpyridin-1-ium-1-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11843218 |
| Molecular Formula | C13H15N4O3+ |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 6-(4-morpholin-4-ylpyridin-1-ium-1-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(-[n+]2ccc(N3CCOCC3)cc2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H14N4O3/c18-12-9-11(14-13(19)15-12)17-3-1-10(2-4-17)16-5-7-20-8-6-16/h1-4,9H,5-8H2,(H-,14,15,18,19)/p+1 |
| InChIKey | QZKKLHUMQHVLOD-UHFFFAOYSA-O |
| XLogP | -0.82 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|