C15H26NO7P — CID 118433499
ethoxy-[(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphinic acid (PubChem CID 118433499) has the molecular formula C15H26NO7P and a molecular weight of 363.35 g/mol. Its IUPAC name is ethoxy-[(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphinic acid.
| Compound Name | ethoxy-[(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphinic acid |
|---|---|
| PubChem CID | 118433499 |
| Molecular Formula | C15H26NO7P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | ethoxy-[(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CC[C@@H](O)[C@@H](O)[C@@H](O)CNOCc1ccccc1 |
| InChI | InChI=1S/C15H26NO7P/c1-2-23-24(20,21)9-8-13(17)15(19)14(18)10-16-22-11-12-6-4-3-5-7-12/h3-7,13-19H,2,8-11H2,1H3,(H,20,21)/t13-,14+,15-/m1/s1 |
| InChIKey | MMPFJUJGBHYDLE-QLFBSQMISA-N |
| XLogP | 0.40 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|