C13H22NO7P — CID 142727369
[(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphonic acid (PubChem CID 142727369) has the molecular formula C13H22NO7P and a molecular weight of 335.29 g/mol. Its IUPAC name is [(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphonic acid.
| Compound Name | [(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphonic acid |
|---|---|
| PubChem CID | 142727369 |
| Molecular Formula | C13H22NO7P |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [(3R,4R,5S)-3,4,5-trihydroxy-6-(phenylmethoxyamino)hexyl]phosphonic acid |
| SMILES | O=P(O)(O)CC[C@@H](O)[C@@H](O)[C@@H](O)CNOCc1ccccc1 |
| InChI | InChI=1S/C13H22NO7P/c15-11(6-7-22(18,19)20)13(17)12(16)8-14-21-9-10-4-2-1-3-5-10/h1-5,11-17H,6-9H2,(H2,18,19,20)/t11-,12+,13-/m1/s1 |
| InChIKey | FEDLYAORGIYMPF-FRRDWIJNSA-N |
| XLogP | -0.64 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|