C17H16F6N2OS — CID 118434196
1-methyl-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole (PubChem CID 118434196) has the molecular formula C17H16F6N2OS and a molecular weight of 410.38 g/mol. Its IUPAC name is 1-methyl-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole.
| Compound Name | 1-methyl-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole |
|---|---|
| PubChem CID | 118434196 |
| Molecular Formula | C17H16F6N2OS |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-methyl-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole |
| SMILES | Cn1nc(C(F)(F)F)cc1C1CC(Sc2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C17H16F6N2OS/c1-25-13(9-15(24-25)17(21,22)23)14-8-12(5-6-26-14)27-11-4-2-3-10(7-11)16(18,19)20/h2-4,7,9,12,14H,5-6,8H2,1H3 |
| InChIKey | OUADOTXMVQVDEN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |