C20H22F6N2O2S — CID 126744260
1-(3-methoxypropyl)-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole (PubChem CID 126744260) has the molecular formula C20H22F6N2O2S and a molecular weight of 468.46 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole.
| Compound Name | 1-(3-methoxypropyl)-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole |
|---|---|
| PubChem CID | 126744260 |
| Molecular Formula | C20H22F6N2O2S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-(3-methoxypropyl)-3-(trifluoromethyl)-5-[4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyrazole |
| SMILES | COCCCn1nc(C(F)(F)F)cc1C1CC(Sc2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C20H22F6N2O2S/c1-29-8-3-7-28-16(12-18(27-28)20(24,25)26)17-11-15(6-9-30-17)31-14-5-2-4-13(10-14)19(21,22)23/h2,4-5,10,12,15,17H,3,6-9,11H2,1H3 |
| InChIKey | JVRUGAPEQFWVNE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|