C16H17F3N2OS — CID 2744586
S-[3-(trifluoromethyl)phenyl] 3-tert-butyl-1-methylpyrazole-5-carbothioate (PubChem CID 2744586) has the molecular formula C16H17F3N2OS and a molecular weight of 342.39 g/mol. Its IUPAC name is S-[3-(trifluoromethyl)phenyl] 3-tert-butyl-1-methylpyrazole-5-carbothioate.
| Compound Name | S-[3-(trifluoromethyl)phenyl] 3-tert-butyl-1-methylpyrazole-5-carbothioate |
|---|---|
| PubChem CID | 2744586 |
| Molecular Formula | C16H17F3N2OS |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | S-[3-(trifluoromethyl)phenyl] 3-tert-butyl-1-methylpyrazole-5-carbothioate |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)Sc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17F3N2OS/c1-15(2,3)13-9-12(21(4)20-13)14(22)23-11-7-5-6-10(8-11)16(17,18)19/h5-9H,1-4H3 |
| InChIKey | LXKREMJNDBQFNM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|