C18H20F2N2O2 — CID 118436670
8-azabicyclo[3.2.1]octan-3-yl 1-(2,2-difluoroethyl)indole-3-carboxylate (PubChem CID 118436670) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 8-azabicyclo[3.2.1]octan-3-yl 1-(2,2-difluoroethyl)indole-3-carboxylate.
| Compound Name | 8-azabicyclo[3.2.1]octan-3-yl 1-(2,2-difluoroethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 118436670 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 8-azabicyclo[3.2.1]octan-3-yl 1-(2,2-difluoroethyl)indole-3-carboxylate |
| SMILES | O=C(OC1CC2CCC(C1)N2)c1cn(CC(F)F)c2ccccc12 |
| InChI | InChI=1S/C18H20F2N2O2/c19-17(20)10-22-9-15(14-3-1-2-4-16(14)22)18(23)24-13-7-11-5-6-12(8-13)21-11/h1-4,9,11-13,17,21H,5-8,10H2 |
| InChIKey | MVROQWKLQDEHNE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |