C12H22O3S — CID 118437130
2-[5-(2-hydroxypropan-2-yl)-2-methylthiolan-2-yl]ethyl acetate (PubChem CID 118437130) has the molecular formula C12H22O3S and a molecular weight of 246.37 g/mol. Its IUPAC name is 2-[5-(2-hydroxypropan-2-yl)-2-methylthiolan-2-yl]ethyl acetate.
| Compound Name | 2-[5-(2-hydroxypropan-2-yl)-2-methylthiolan-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 118437130 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[5-(2-hydroxypropan-2-yl)-2-methylthiolan-2-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1(C)CCC(C(C)(C)O)S1 |
| InChI | InChI=1S/C12H22O3S/c1-9(13)15-8-7-12(4)6-5-10(16-12)11(2,3)14/h10,14H,5-8H2,1-4H3 |
| InChIKey | YICJRPXETGJIOD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |