C18H31O3+ — CID 138965470
2-[(1S,2R,8aS)-2-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydronaphthalen-4a-ylium-1-yl]ethyl acetate (PubChem CID 138965470) has the molecular formula C18H31O3+ and a molecular weight of 295.44 g/mol. Its IUPAC name is 2-[(1S,2R,8aS)-2-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydronaphthalen-4a-ylium-1-yl]ethyl acetate.
| Compound Name | 2-[(1S,2R,8aS)-2-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydronaphthalen-4a-ylium-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 138965470 |
| Molecular Formula | C18H31O3+ |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-[(1S,2R,8aS)-2-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydronaphthalen-4a-ylium-1-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@]1(C)[C@H]2CCCC(C)(C)[C+]2CC[C@@]1(C)O |
| InChI | InChI=1S/C18H31O3/c1-13(19)21-12-11-17(4)15-7-6-9-16(2,3)14(15)8-10-18(17,5)20/h15,20H,6-12H2,1-5H3/q+1/t15-,17-,18+/m0/s1 |
| InChIKey | KRWFVNCZHDJPKV-RYQLBKOJSA-N |
| XLogP | 3.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|