C16H15N5O2 — CID 11843723
[2-(4-methoxyphenyl)-5-phenyltriazol-4-yl]urea (PubChem CID 11843723) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-5-phenyltriazol-4-yl]urea.
| Compound Name | [2-(4-methoxyphenyl)-5-phenyltriazol-4-yl]urea |
|---|---|
| PubChem CID | 11843723 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [2-(4-methoxyphenyl)-5-phenyltriazol-4-yl]urea |
| SMILES | COc1ccc(-n2nc(NC(N)=O)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H15N5O2/c1-23-13-9-7-12(8-10-13)21-19-14(11-5-3-2-4-6-11)15(20-21)18-16(17)22/h2-10H,1H3,(H3,17,18,20,22) |
| InChIKey | UJFVJDGTTJMVNK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |