C21H22N4O5 — CID 162243082
2-(4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid;3-oxo-N-phenylbutanamide (PubChem CID 162243082) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid;3-oxo-N-phenylbutanamide.
| Compound Name | 2-(4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid;3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 162243082 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-methyltriazole-4-carboxylic acid;3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccccc1.COc1ccc(-n2nc(C)c(C(=O)O)n2)cc1 |
| InChI | InChI=1S/C11H11N3O3.C10H11NO2/c1-7-10(11(15)16)13-14(12-7)8-3-5-9(17-2)6-4-8;1-8(12)7-10(13)11-9-5-3-2-4-6-9/h3-6H,1-2H3,(H,15,16);2-6H,7H2,1H3,(H,11,13) |
| InChIKey | ZWYUHTAJZQCKLN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|