C21H28FN5O2 — CID 118439976
N-[(4-fluorophenyl)methyl]-6-hydroxy-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide (PubChem CID 118439976) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-hydroxy-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-hydroxy-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide |
|---|---|
| PubChem CID | 118439976 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-hydroxy-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cnc2nc1NCCCC(O)CCCCCN2 |
| InChI | InChI=1S/C21H28FN5O2/c22-16-9-7-15(8-10-16)13-25-20(29)18-14-26-21-24-11-3-1-2-5-17(28)6-4-12-23-19(18)27-21/h7-10,14,17,28H,1-6,11-13H2,(H,25,29)(H2,23,24,26,27) |
| InChIKey | YHMGOBNDJFRITK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |