C24H31N7O2 — CID 118439981
6-hydroxy-N-[(4-imidazol-1-ylphenyl)methyl]-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide (PubChem CID 118439981) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 6-hydroxy-N-[(4-imidazol-1-ylphenyl)methyl]-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide.
| Compound Name | 6-hydroxy-N-[(4-imidazol-1-ylphenyl)methyl]-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide |
|---|---|
| PubChem CID | 118439981 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 6-hydroxy-N-[(4-imidazol-1-ylphenyl)methyl]-2,12,14,17-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-triene-16-carboxamide |
| SMILES | O=C(NCc1ccc(-n2ccnc2)cc1)c1cnc2nc1NCCCC(O)CCCCCN2 |
| InChI | InChI=1S/C24H31N7O2/c32-20-5-2-1-3-11-27-24-29-16-21(22(30-24)26-12-4-6-20)23(33)28-15-18-7-9-19(10-8-18)31-14-13-25-17-31/h7-10,13-14,16-17,20,32H,1-6,11-12,15H2,(H,28,33)(H2,26,27,29,30) |
| InChIKey | UUNDTGMLLWWLEW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |