C21H28FN7O2 — CID 123722340
9-amino-N-[(4-fluorophenyl)methyl]-8-oxo-2,7,13,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-15-carboxamide (PubChem CID 123722340) has the molecular formula C21H28FN7O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 9-amino-N-[(4-fluorophenyl)methyl]-8-oxo-2,7,13,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-15-carboxamide.
| Compound Name | 9-amino-N-[(4-fluorophenyl)methyl]-8-oxo-2,7,13,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-15-carboxamide |
|---|---|
| PubChem CID | 123722340 |
| Molecular Formula | C21H28FN7O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 9-amino-N-[(4-fluorophenyl)methyl]-8-oxo-2,7,13,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-15-carboxamide |
| SMILES | NC1CCCNc2nc(ncc2C(=O)NCc2ccc(F)cc2)NCCCCNC1=O |
| InChI | InChI=1S/C21H28FN7O2/c22-15-7-5-14(6-8-15)12-27-19(30)16-13-28-21-26-10-2-1-9-25-20(31)17(23)4-3-11-24-18(16)29-21/h5-8,13,17H,1-4,9-12,23H2,(H,25,31)(H,27,30)(H2,24,26,28,29) |
| InChIKey | IOMWVMYUMOZHRM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |