C15H15N3O2S3 — CID 118440267
(1R,3R,4S,7R)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-4-thiophen-2-yl-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile (PubChem CID 118440267) has the molecular formula C15H15N3O2S3 and a molecular weight of 365.51 g/mol. Its IUPAC name is (1R,3R,4S,7R)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-4-thiophen-2-yl-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile.
| Compound Name | (1R,3R,4S,7R)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-4-thiophen-2-yl-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
|---|---|
| PubChem CID | 118440267 |
| Molecular Formula | C15H15N3O2S3 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (1R,3R,4S,7R)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-4-thiophen-2-yl-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
| SMILES | CN1C(=O)[C@]23C[C@@](C)(C#N)[C@@H](c4cccs4)N2C(=O)[C@@]1(C)S3=S |
| InChI | InChI=1S/C15H15N3O2S3/c1-13(8-16)7-15-12(20)17(3)14(2,23(15)21)11(19)18(15)10(13)9-5-4-6-22-9/h4-6,10H,7H2,1-3H3/t10-,13+,14-,15-,23?/m1/s1 |
| InChIKey | XGOFATOLXJBOFL-MDCYZPDVSA-N |
| XLogP | 1.53 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |