C19H19N3O5S2 — CID 126551558
(3S)-4-(1,3-benzodioxol-5-yl)-3-(2-hydroxyethyl)-7,8-dimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile (PubChem CID 126551558) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is (3S)-4-(1,3-benzodioxol-5-yl)-3-(2-hydroxyethyl)-7,8-dimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile.
| Compound Name | (3S)-4-(1,3-benzodioxol-5-yl)-3-(2-hydroxyethyl)-7,8-dimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
|---|---|
| PubChem CID | 126551558 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | (3S)-4-(1,3-benzodioxol-5-yl)-3-(2-hydroxyethyl)-7,8-dimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
| SMILES | CN1C(=O)C23C[C@@](C#N)(CCO)C(c4ccc5c(c4)OCO5)N2C(=O)C1(C)S3=S |
| InChI | InChI=1S/C19H19N3O5S2/c1-17-15(24)22-14(11-3-4-12-13(7-11)27-10-26-12)18(9-20,5-6-23)8-19(22,29(17)28)16(25)21(17)2/h3-4,7,14,23H,5-6,8,10H2,1-2H3/t14?,17?,18-,19?,29?/m1/s1 |
| InChIKey | JBGWKQOQMRXTKK-NTBZFGGCSA-N |
| XLogP | 0.56 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |