C18H17N3O4S3 — CID 140771064
(1S,3S)-4-(1,3-benzodioxol-5-yl)-3-isocyano-3,7,8-trimethyl-10-(sulfanylidene-λ4-sulfanylidene)-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione (PubChem CID 140771064) has the molecular formula C18H17N3O4S3 and a molecular weight of 435.55 g/mol. Its IUPAC name is (1S,3S)-4-(1,3-benzodioxol-5-yl)-3-isocyano-3,7,8-trimethyl-10-(sulfanylidene-λ4-sulfanylidene)-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione.
| Compound Name | (1S,3S)-4-(1,3-benzodioxol-5-yl)-3-isocyano-3,7,8-trimethyl-10-(sulfanylidene-λ4-sulfanylidene)-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione |
|---|---|
| PubChem CID | 140771064 |
| Molecular Formula | C18H17N3O4S3 |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | (1S,3S)-4-(1,3-benzodioxol-5-yl)-3-isocyano-3,7,8-trimethyl-10-(sulfanylidene-λ4-sulfanylidene)-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione |
| SMILES | [C-]#[N+][C@@]1(C)C[C@]23C(=O)N(C)C(C)(C(=O)N2C1c1ccc2c(c1)OCO2)S3=S=S |
| InChI | InChI=1S/C18H17N3O4S3/c1-16(19-3)8-18-15(23)20(4)17(2,28(18)27-26)14(22)21(18)13(16)10-5-6-11-12(7-10)25-9-24-11/h5-7,13H,8-9H2,1-2,4H3/t13?,16-,17?,18-,28?/m0/s1 |
| InChIKey | KVXUXNPLOXDCOC-QTOFLZQASA-N |
| XLogP | 1.34 |
| TPSA | 63.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|