C23H21N3O2S2 — CID 140694057
(1S,3S,4S,7S)-3-isocyano-3,7,8-trimethyl-4-(4-phenylphenyl)-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione (PubChem CID 140694057) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (1S,3S,4S,7S)-3-isocyano-3,7,8-trimethyl-4-(4-phenylphenyl)-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione.
| Compound Name | (1S,3S,4S,7S)-3-isocyano-3,7,8-trimethyl-4-(4-phenylphenyl)-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione |
|---|---|
| PubChem CID | 140694057 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (1S,3S,4S,7S)-3-isocyano-3,7,8-trimethyl-4-(4-phenylphenyl)-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-6,9-dione |
| SMILES | [C-]#[N+][C@@]1(C)C[C@]23C(=O)N(C)[C@](C)(C(=O)N2[C@H]1c1ccc(-c2ccccc2)cc1)S3=S |
| InChI | InChI=1S/C23H21N3O2S2/c1-21(24-3)14-23-20(28)25(4)22(2,30(23)29)19(27)26(23)18(21)17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-13,18H,14H2,1-2,4H3/t18-,21-,22-,23-,30?/m0/s1 |
| InChIKey | JXUPZBXCHCGCBT-PMCZLSRBSA-N |
| XLogP | 3.28 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|