C25H22N4O4S3 — CID 158862812
(1S,3S,7S)-3-isocyano-3,7,11-trimethyl-4-(1-phenylindol-3-yl)-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione;sulfur dioxide (PubChem CID 158862812) has the molecular formula C25H22N4O4S3 and a molecular weight of 538.68 g/mol. Its IUPAC name is (1S,3S,7S)-3-isocyano-3,7,11-trimethyl-4-(1-phenylindol-3-yl)-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione;sulfur dioxide.
| Compound Name | (1S,3S,7S)-3-isocyano-3,7,11-trimethyl-4-(1-phenylindol-3-yl)-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione;sulfur dioxide |
|---|---|
| PubChem CID | 158862812 |
| Molecular Formula | C25H22N4O4S3 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | (1S,3S,7S)-3-isocyano-3,7,11-trimethyl-4-(1-phenylindol-3-yl)-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione;sulfur dioxide |
| SMILES | O=S=O.[C-]#[N+][C@@]1(C)C[C@@]23SS[C@@](C)(C(=O)N2C1c1cn(-c2ccccc2)c2ccccc12)N(C)C3=O |
| InChI | InChI=1S/C25H22N4O2S2.O2S/c1-23(26-3)15-25-22(31)27(4)24(2,32-33-25)21(30)29(25)20(23)18-14-28(16-10-6-5-7-11-16)19-13-9-8-12-17(18)19;1-3-2/h5-14,20H,15H2,1-2,4H3;/t20?,23-,24-,25-;/m0./s1 |
| InChIKey | JAVXFEYWIHWUBT-KIIVNTQPSA-N |
| XLogP | 4.19 |
| TPSA | 84.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|