C20H19N3O4S2 — CID 123267782
(1S,3S,7S)-4-(1,3-benzodioxol-5-yl)-11-cyclopropyl-3-isocyano-3,7-dimethyl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione (PubChem CID 123267782) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (1S,3S,7S)-4-(1,3-benzodioxol-5-yl)-11-cyclopropyl-3-isocyano-3,7-dimethyl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione.
| Compound Name | (1S,3S,7S)-4-(1,3-benzodioxol-5-yl)-11-cyclopropyl-3-isocyano-3,7-dimethyl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione |
|---|---|
| PubChem CID | 123267782 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (1S,3S,7S)-4-(1,3-benzodioxol-5-yl)-11-cyclopropyl-3-isocyano-3,7-dimethyl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-6,10-dione |
| SMILES | [C-]#[N+][C@@]1(C)C[C@@]23SS[C@@](C)(C(=O)N2C1c1ccc2c(c1)OCO2)N(C1CC1)C3=O |
| InChI | InChI=1S/C20H19N3O4S2/c1-18(21-3)9-20-17(25)22(12-5-6-12)19(2,28-29-20)16(24)23(20)15(18)11-4-7-13-14(8-11)27-10-26-13/h4,7-8,12,15H,5-6,9-10H2,1-2H3/t15?,18-,19-,20-/m0/s1 |
| InChIKey | VCZNCWLADNOGHO-FBOXXWIASA-N |
| XLogP | 3.18 |
| TPSA | 63.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|