C24H23N3O4 — CID 123423792
(7S,8aS)-6-(1,3-benzodioxol-5-yl)-3-benzyl-7-isocyano-2,7-dimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 123423792) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (7S,8aS)-6-(1,3-benzodioxol-5-yl)-3-benzyl-7-isocyano-2,7-dimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (7S,8aS)-6-(1,3-benzodioxol-5-yl)-3-benzyl-7-isocyano-2,7-dimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 123423792 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (7S,8aS)-6-(1,3-benzodioxol-5-yl)-3-benzyl-7-isocyano-2,7-dimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | [C-]#[N+][C@@]1(C)C[C@H]2C(=O)N(C)C(Cc3ccccc3)C(=O)N2C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H23N3O4/c1-24(25-2)13-18-22(28)26(3)17(11-15-7-5-4-6-8-15)23(29)27(18)21(24)16-9-10-19-20(12-16)31-14-30-19/h4-10,12,17-18,21H,11,13-14H2,1,3H3/t17?,18-,21?,24-/m0/s1 |
| InChIKey | FXUARLWNPBXADK-VPFMIBCWSA-N |
| XLogP | 2.82 |
| TPSA | 63.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|