C21H23N3O4 — CID 134578657
(3R,6S,8aS)-6-(1,3-benzodioxol-5-yl)-2-cyclopropyl-7-ethyl-3-methyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 134578657) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is (3R,6S,8aS)-6-(1,3-benzodioxol-5-yl)-2-cyclopropyl-7-ethyl-3-methyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3R,6S,8aS)-6-(1,3-benzodioxol-5-yl)-2-cyclopropyl-7-ethyl-3-methyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 134578657 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (3R,6S,8aS)-6-(1,3-benzodioxol-5-yl)-2-cyclopropyl-7-ethyl-3-methyl-1,4-dioxo-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | CCC1(C#N)C[C@H]2C(=O)N(C3CC3)[C@H](C)C(=O)N2[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N3O4/c1-3-21(10-22)9-15-20(26)23(14-5-6-14)12(2)19(25)24(15)18(21)13-4-7-16-17(8-13)28-11-27-16/h4,7-8,12,14-15,18H,3,5-6,9,11H2,1-2H3/t12-,15+,18+,21?/m1/s1 |
| InChIKey | AAYQGBQJVWQAOL-OKWRLXOXSA-N |
| XLogP | 2.37 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |