C22H26N4O5S — CID 142483224
(3S,6S,7R,8aS)-6-(1,3-benzodioxol-5-yl)-2,3-dimethyl-7-(morpholin-4-ylmethyl)-1,4-dioxo-8a-sulfanyl-6,8-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 142483224) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is (3S,6S,7R,8aS)-6-(1,3-benzodioxol-5-yl)-2,3-dimethyl-7-(morpholin-4-ylmethyl)-1,4-dioxo-8a-sulfanyl-6,8-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3S,6S,7R,8aS)-6-(1,3-benzodioxol-5-yl)-2,3-dimethyl-7-(morpholin-4-ylmethyl)-1,4-dioxo-8a-sulfanyl-6,8-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 142483224 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (3S,6S,7R,8aS)-6-(1,3-benzodioxol-5-yl)-2,3-dimethyl-7-(morpholin-4-ylmethyl)-1,4-dioxo-8a-sulfanyl-6,8-dihydro-3H-pyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | C[C@H]1C(=O)N2[C@@H](c3ccc4c(c3)OCO4)[C@](C#N)(CN3CCOCC3)C[C@]2(S)C(=O)N1C |
| InChI | InChI=1S/C22H26N4O5S/c1-14-19(27)26-18(15-3-4-16-17(9-15)31-13-30-16)21(11-23,12-25-5-7-29-8-6-25)10-22(26,32)20(28)24(14)2/h3-4,9,14,18,32H,5-8,10,12-13H2,1-2H3/t14-,18-,21+,22-/m0/s1 |
| InChIKey | PIVSJXSTFBUCHU-DNEUNLEDSA-N |
| XLogP | 1.02 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|