C21H41NO6 — CID 118440290
2-[[(6R)-6-butoxy-6-hydroxyhexoxy]carbonyl-ethylamino]ethyl 2,2-dimethylbutanoate (PubChem CID 118440290) has the molecular formula C21H41NO6 and a molecular weight of 403.56 g/mol. Its IUPAC name is 2-[[(6R)-6-butoxy-6-hydroxyhexoxy]carbonyl-ethylamino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[(6R)-6-butoxy-6-hydroxyhexoxy]carbonyl-ethylamino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118440290 |
| Molecular Formula | C21H41NO6 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 2-[[(6R)-6-butoxy-6-hydroxyhexoxy]carbonyl-ethylamino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCCCO[C@@H](O)CCCCCOC(=O)N(CC)CCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C21H41NO6/c1-6-9-15-26-18(23)13-11-10-12-16-28-20(25)22(8-3)14-17-27-19(24)21(4,5)7-2/h18,23H,6-17H2,1-5H3/t18-/m1/s1 |
| InChIKey | WVQXMYQTFAJHGV-GOSISDBHSA-N |
| XLogP | 4.12 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|