C20H21F4N5O4 — CID 118440845
N-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoro-2-methoxyethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide (PubChem CID 118440845) has the molecular formula C20H21F4N5O4 and a molecular weight of 471.41 g/mol. Its IUPAC name is N-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoro-2-methoxyethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide.
| Compound Name | N-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoro-2-methoxyethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118440845 |
| Molecular Formula | C20H21F4N5O4 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[3-[(4R,5R,6S)-2-amino-6-(1,1-difluoro-2-methoxyethyl)-5-fluoro-4-methyl-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-methoxypyrazine-2-carboxamide |
| SMILES | COCC(F)(F)[C@H]1OC(N)=N[C@](C)(c2cc(NC(=O)c3cnc(OC)cn3)ccc2F)[C@H]1F |
| InChI | InChI=1S/C20H21F4N5O4/c1-19(15(22)16(33-18(25)29-19)20(23,24)9-31-2)11-6-10(4-5-12(11)21)28-17(30)13-7-27-14(32-3)8-26-13/h4-8,15-16H,9H2,1-3H3,(H2,25,29)(H,28,30)/t15-,16-,19+/m0/s1 |
| InChIKey | DENHJGQLLDJUHJ-TXPKVOOTSA-N |
| XLogP | 2.43 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |