C29H45NO3S3 — CID 11844180
(2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-2-[(1R)-1-hydroxy-2-(2-pentyl-1,3-dithian-2-yl)ethyl]octan-1-one (PubChem CID 11844180) has the molecular formula C29H45NO3S3 and a molecular weight of 551.88 g/mol. Its IUPAC name is (2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-2-[(1R)-1-hydroxy-2-(2-pentyl-1,3-dithian-2-yl)ethyl]octan-1-one.
| Compound Name | (2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-2-[(1R)-1-hydroxy-2-(2-pentyl-1,3-dithian-2-yl)ethyl]octan-1-one |
|---|---|
| PubChem CID | 11844180 |
| Molecular Formula | C29H45NO3S3 |
| Molecular Weight | 551.88 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | (2S)-1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-2-[(1R)-1-hydroxy-2-(2-pentyl-1,3-dithian-2-yl)ethyl]octan-1-one |
| SMILES | CCCCCC[C@H](C(=O)N1C(=S)OC[C@@H]1Cc1ccccc1)[C@H](O)CC1(CCCCC)SCCCS1 |
| InChI | InChI=1S/C29H45NO3S3/c1-3-5-7-11-16-25(26(31)21-29(17-12-6-4-2)35-18-13-19-36-29)27(32)30-24(22-33-28(30)34)20-23-14-9-8-10-15-23/h8-10,14-15,24-26,31H,3-7,11-13,16-22H2,1-2H3/t24-,25-,26+/m0/s1 |
| InChIKey | FNXWBXAPOIDHKL-KKUQBAQOSA-N |
| XLogP | 7.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.88 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|