C23H31O4PS — CID 118442005
(3S,4S,6R)-2-(dimethylphosphoryloxymethyl)-3,4-dimethyl-5-phenylmethoxy-6-phenylsulfanyloxane (PubChem CID 118442005) has the molecular formula C23H31O4PS and a molecular weight of 434.54 g/mol. Its IUPAC name is (3S,4S,6R)-2-(dimethylphosphoryloxymethyl)-3,4-dimethyl-5-phenylmethoxy-6-phenylsulfanyloxane.
| Compound Name | (3S,4S,6R)-2-(dimethylphosphoryloxymethyl)-3,4-dimethyl-5-phenylmethoxy-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 118442005 |
| Molecular Formula | C23H31O4PS |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (3S,4S,6R)-2-(dimethylphosphoryloxymethyl)-3,4-dimethyl-5-phenylmethoxy-6-phenylsulfanyloxane |
| SMILES | C[C@@H]1C(COP(C)(C)=O)O[C@H](Sc2ccccc2)C(OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H31O4PS/c1-17-18(2)22(25-15-19-11-7-5-8-12-19)23(29-20-13-9-6-10-14-20)27-21(17)16-26-28(3,4)24/h5-14,17-18,21-23H,15-16H2,1-4H3/t17-,18-,21?,22?,23+/m0/s1 |
| InChIKey | FTROQCZJZHPQMQ-GXOPUDRZSA-N |
| XLogP | 5.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|