C22H22ClN3O — CID 118443713
1-[5-(4-chlorophenyl)-2-pyridinyl]-1-cyclopentyl-2-pyrimidin-5-ylethanol (PubChem CID 118443713) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-2-pyridinyl]-1-cyclopentyl-2-pyrimidin-5-ylethanol.
| Compound Name | 1-[5-(4-chlorophenyl)-2-pyridinyl]-1-cyclopentyl-2-pyrimidin-5-ylethanol |
|---|---|
| PubChem CID | 118443713 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-2-pyridinyl]-1-cyclopentyl-2-pyrimidin-5-ylethanol |
| SMILES | OC(Cc1cncnc1)(c1ccc(-c2ccc(Cl)cc2)cn1)C1CCCC1 |
| InChI | InChI=1S/C22H22ClN3O/c23-20-8-5-17(6-9-20)18-7-10-21(26-14-18)22(27,19-3-1-2-4-19)11-16-12-24-15-25-13-16/h5-10,12-15,19,27H,1-4,11H2 |
| InChIKey | OSSZJVNIULCVJR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |