C10H21NO2S — CID 118445885
4-tert-butyl-3-propan-2-yl-1,3-thiazolidine 1,1-dioxide (PubChem CID 118445885) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 4-tert-butyl-3-propan-2-yl-1,3-thiazolidine 1,1-dioxide.
| Compound Name | 4-tert-butyl-3-propan-2-yl-1,3-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 118445885 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 4-tert-butyl-3-propan-2-yl-1,3-thiazolidine 1,1-dioxide |
| SMILES | CC(C)N1CS(=O)(=O)CC1C(C)(C)C |
| InChI | InChI=1S/C10H21NO2S/c1-8(2)11-7-14(12,13)6-9(11)10(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | XKZAQPSEBBBJRC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |