About 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide
8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide (PubChem CID 146188761) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide.
Analyze 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide?
The IUPAC name of 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide (CID 146188761) is 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide.
What is the SMILES notation for 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide?
The canonical SMILES for 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide is CC(C)N1C2CCC1CS(=O)(=O)C2.
What is the InChIKey of 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide?
The InChIKey is YXFTXZNVGQSRDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-7(2)10-8-3-4-9(10)6-13(11,12)5-8/h7-9H,3-6H2,1-2H3.
What are the key properties of 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide?
8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide has a molecular weight of 203.31 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-yl-3λ6-thia-8-azabicyclo[3.2.1]octane 3,3-dioxide is sourced from PubChem (CID 146188761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).