C20H42O3Si — CID 11844710
(Z,2R,3S,4S,5R)-2-methoxy-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-4-ol (PubChem CID 11844710) has the molecular formula C20H42O3Si and a molecular weight of 358.64 g/mol. Its IUPAC name is (Z,2R,3S,4S,5R)-2-methoxy-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-4-ol.
| Compound Name | (Z,2R,3S,4S,5R)-2-methoxy-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-4-ol |
|---|---|
| PubChem CID | 11844710 |
| Molecular Formula | C20H42O3Si |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | (Z,2R,3S,4S,5R)-2-methoxy-3,5-dimethyl-1-tri(propan-2-yl)silyloxyoct-6-en-4-ol |
| SMILES | C/C=C\[C@@H](C)[C@H](O)[C@H](C)[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C20H42O3Si/c1-11-12-17(8)20(21)18(9)19(22-10)13-23-24(14(2)3,15(4)5)16(6)7/h11-12,14-21H,13H2,1-10H3/b12-11-/t17-,18-,19+,20+/m1/s1 |
| InChIKey | HBRMDRVMNWYXIW-MOJNAGKVSA-N |
| XLogP | 5.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|