C16H32O3Si — CID 102322037
(4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol (PubChem CID 102322037) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol.
| Compound Name | (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol |
|---|---|
| PubChem CID | 102322037 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol |
| SMILES | CC(C)[Si](OC[C@H](O)[C@@H](C)C#CCO)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-12(2)20(13(3)4,14(5)6)19-11-16(18)15(7)9-8-10-17/h12-18H,10-11H2,1-7H3/t15-,16-/m0/s1 |
| InChIKey | PGHRFJJMLWAJIA-HOTGVXAUSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|