About (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol
(4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol (PubChem CID 102322037) has the molecular formula C16H32O3Si
and a molecular weight of 300.52 g/mol. Its IUPAC name is (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol.
Molecular Properties
| Compound Name | (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol |
| PubChem CID | 102322037 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol |
| SMILES | CC(C)[Si](OC[C@H](O)[C@@H](C)C#CCO)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-12(2)20(13(3)4,14(5)6)19-11-16(18)15(7)9-8-10-17/h12-18H,10-11H2,1-7H3/t15-,16-/m0/s1 |
| InChIKey | PGHRFJJMLWAJIA-HOTGVXAUSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol?
The IUPAC name of (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol (CID 102322037) is (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol.
What is the SMILES notation for (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol?
The canonical SMILES for (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol is CC(C)[Si](OC[C@H](O)[C@@H](C)C#CCO)(C(C)C)C(C)C.
What is the InChIKey of (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol?
The InChIKey is PGHRFJJMLWAJIA-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H32O3Si/c1-12(2)20(13(3)4,14(5)6)19-11-16(18)15(7)9-8-10-17/h12-18H,10-11H2,1-7H3/t15-,16-/m0/s1.
What are the key properties of (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol?
(4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol has a molecular weight of 300.52 g/mol, XLogP of 3.17, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4-methyl-6-tri(propan-2-yl)silyloxyhex-2-yne-1,5-diol is sourced from PubChem (CID 102322037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).